Products 521979-66-8

CAS 521979-66-8 is the registry number for LMD-584. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[4-hydroxy-1-[[3-(2-methoxyphenoxy)phenyl]methyl]piperidin-4-yl]benzoic acid (CAS 521979-66-8) is a chemical compound with the molecular formula C26H27NO5 and a molecular weight of 433.5 g/mol. IUPAC name: 2-[4-hydroxy-1-[[3-(2-methoxyphenoxy)phenyl]methyl]piperidin-4-yl]benzoic acid. InChIKey: OPPQPMWDSDAYMV-UHFFFAOYSA-N.

Identity
Molecular formulaC26H27NO5
Molecular weight433.5 g/mol
IUPAC name2-[4-hydroxy-1-[[3-(2-methoxyphenoxy)phenyl]methyl]piperidin-4-yl]benzoic acid
InChIKeyOPPQPMWDSDAYMV-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1OC2=CC=CC(=C2)CN3CCC(CC3)(C4=CC=CC=C4C(=O)O)O

Computed by PubChem (NCBI)

Synonyms: orb3136615