Products 1902220-23-8
CAS 1902220-23-8 is the registry number for Rel-(1R,6S,7R)-2-hydroxybicyclo[4.1.0]heptane-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,6S,7R)-2-hydroxybicyclo[4.1.0]heptane-7-carboxylic acid (CAS 1902220-23-8) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: (1R,6S,7R)-2-hydroxybicyclo[4.1.0]heptane-7-carboxylic acid. InChIKey: YUMFKRILFAXRCU-HNMQFRHFSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (1R,6S,7R)-2-hydroxybicyclo[4.1.0]heptane-7-carboxylic acid |
| InChIKey | YUMFKRILFAXRCU-HNMQFRHFSA-N |
| SMILES | C1C[C@H]2[C@H]([C@@H]2C(=O)O)C(C1)O |
Computed by PubChem (NCBI)