Products 1933506-01-4
CAS 1933506-01-4 is the registry number for (1S,6R,7S)-2-Hydroxybicyclo[4.1.0]heptane-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,6R,7S)-2-hydroxybicyclo[4.1.0]heptane-7-carboxylic acid (CAS 1933506-01-4) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: (1S,6R,7S)-2-hydroxybicyclo[4.1.0]heptane-7-carboxylic acid. InChIKey: YUMFKRILFAXRCU-ZUMNNYEFSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (1S,6R,7S)-2-hydroxybicyclo[4.1.0]heptane-7-carboxylic acid |
| InChIKey | YUMFKRILFAXRCU-ZUMNNYEFSA-N |
| SMILES | C1C[C@@H]2[C@@H]([C@H]2C(=O)O)C(C1)O |
Computed by PubChem (NCBI)