Products 19027-23-7

CAS 19027-23-7 appears in our catalog under these names: Spiro(4.5)decane-8-carboxylic acid, 98%, Spiro(4.5)decane-8-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Spiro[4.5]decane-8-carboxylic acid (CAS 19027-23-7) is a chemical compound with the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. IUPAC name: spiro[4.5]decane-8-carboxylic acid. InChIKey: NOHIIJZANZJPGI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O2
Molecular weight182.26 g/mol
IUPAC namespiro[4.5]decane-8-carboxylic acid
InChIKeyNOHIIJZANZJPGI-UHFFFAOYSA-N
SMILESC1CCC2(C1)CCC(CC2)C(=O)O

Computed by PubChem (NCBI)