Products 1902847-24-8
CAS 1902847-24-8 is the registry number for N1-[2,6-Bis(1-methylethyl)phenyl]-N2-(2-pyridinylmethyl)ethanediamide, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
N'-[2,6-di(propan-2-yl)phenyl]-N-(pyridin-2-ylmethyl)oxamide (CAS 1902847-24-8) is a chemical compound with the molecular formula C20H25N3O2 and a molecular weight of 339.4 g/mol. IUPAC name: N'-[2,6-di(propan-2-yl)phenyl]-N-(pyridin-2-ylmethyl)oxamide. InChIKey: WSXOAOIHNDRREW-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | N'-[2,6-di(propan-2-yl)phenyl]-N-(pyridin-2-ylmethyl)oxamide |
| InChIKey | WSXOAOIHNDRREW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NC(=O)C(=O)NCC2=CC=CC=N2 |
Computed by PubChem (NCBI)