Products 190322-72-6
CAS 190322-72-6 is the registry number for O8-tert-butyl O2-methyl endo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
8-O-tert-butyl 2-O-methyl (1R,2R,5R)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 190322-72-6) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl (1R,2R,5R)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: NZHFCUPQNWPYIB-GMTAPVOTSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl (1R,2R,5R)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| InChIKey | NZHFCUPQNWPYIB-GMTAPVOTSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]([C@H]1CC2)C(=O)OC |
Computed by PubChem (NCBI)