CAS 172172-50-8 is the registry number for 8-(tert-Butyl) 2-methyl (1R,2S,5R)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-O-tert-butyl 2-O-methyl (1R,2S,5R)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 172172-50-8) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl (1R,2S,5R)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: NZHFCUPQNWPYIB-OUAUKWLOSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl (1R,2S,5R)-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| InChIKey | NZHFCUPQNWPYIB-OUAUKWLOSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H]([C@H]1CC2)C(=O)OC |
Computed by PubChem (NCBI)