CAS 1903430-05-6 is the registry number for (1S,2S)-rel-4,4-Difluorocyclopentane-1,2-diol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1R,2R)-4,4-difluorocyclopentane-1,2-diol (CAS 1903430-05-6) is a chemical compound with the molecular formula C5H8F2O2 and a molecular weight of 138.11 g/mol. IUPAC name: trans-(1R,2R)-4,4-difluorocyclopentane-1,2-diol. InChIKey: RQJNPJXCMOLSSC-QWWZWVQMSA-N.
| Molecular formula | C5H8F2O2 |
|---|---|
| Molecular weight | 138.11 g/mol |
| IUPAC name | trans-(1R,2R)-4,4-difluorocyclopentane-1,2-diol |
| InChIKey | RQJNPJXCMOLSSC-QWWZWVQMSA-N |
| SMILES | C1[C@H]([C@@H](CC1(F)F)O)O |
Computed by PubChem (NCBI)