CAS 2173082-22-7 appears in our catalog under these names: Rel-(1R,2S)-4,4-difluorocyclopentane-1,2-diol, 98%, rel-(1R,2S)-4,4-Difluorocyclopentane-1,2-diol, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 25mg.
Cis-(1R,2S)-4,4-difluorocyclopentane-1,2-diol (CAS 2173082-22-7) is a chemical compound with the molecular formula C5H8F2O2 and a molecular weight of 138.11 g/mol. IUPAC name: cis-(1R,2S)-4,4-difluorocyclopentane-1,2-diol. InChIKey: RQJNPJXCMOLSSC-ZXZARUISSA-N.
| Molecular formula | C5H8F2O2 |
|---|---|
| Molecular weight | 138.11 g/mol |
| IUPAC name | cis-(1R,2S)-4,4-difluorocyclopentane-1,2-diol |
| InChIKey | RQJNPJXCMOLSSC-ZXZARUISSA-N |
| SMILES | C1[C@H]([C@H](CC1(F)F)O)O |
Computed by PubChem (NCBI)