CAS 1903787-82-5 is the registry number for rac-Methyl (2R,3R)-2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (2S,3S)-2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate;hydrochloride (CAS 1903787-82-5) is a chemical compound with the molecular formula C6H12ClF2NO3 and a molecular weight of 219.61 g/mol. IUPAC name: methyl (2S,3S)-2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate;hydrochloride. InChIKey: NVRRUOSYRXIJFJ-QEUBVXLQSA-N.
| Molecular formula | C6H12ClF2NO3 |
|---|---|
| Molecular weight | 219.61 g/mol |
| IUPAC name | methyl (2S,3S)-2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate;hydrochloride |
| InChIKey | NVRRUOSYRXIJFJ-QEUBVXLQSA-N |
| SMILES | C[C@]([C@@H](C(=O)OC)N)(C(F)F)O.Cl |
Computed by PubChem (NCBI)