CAS 2309449-01-0 is the registry number for Methyl 2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate;hydrochloride (CAS 2309449-01-0) is a chemical compound with the molecular formula C6H12ClF2NO3 and a molecular weight of 219.61 g/mol. IUPAC name: methyl 2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate;hydrochloride. InChIKey: NVRRUOSYRXIJFJ-UHFFFAOYSA-N.
| Molecular formula | C6H12ClF2NO3 |
|---|---|
| Molecular weight | 219.61 g/mol |
| IUPAC name | methyl 2-amino-4,4-difluoro-3-hydroxy-3-methylbutanoate;hydrochloride |
| InChIKey | NVRRUOSYRXIJFJ-UHFFFAOYSA-N |
| SMILES | CC(C(C(=O)OC)N)(C(F)F)O.Cl |
Computed by PubChem (NCBI)