CAS 1904-78-5 appears in our catalog under these names: (2–Nitrophenyl)methanamine, (2-Nitrophenyl)methanamine 98%, (2-Nitrophenyl)methanamine, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 500mg, 250mg, 1g, 5g.
(2-nitrophenyl)methanamine (CAS 1904-78-5) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: (2-nitrophenyl)methanamine. InChIKey: PYYRNLDFMZVKCV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | (2-nitrophenyl)methanamine |
| InChIKey | PYYRNLDFMZVKCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)[N+](=O)[O-] |
Computed by PubChem (NCBI)