Products 190448-73-8
CAS 190448-73-8 appears in our catalog under these names: 5-Aminomethyluridine, 5-(Aminomethyl)uridine, 98.74%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 5 mg, 50 mg, 10 mg, 1 mg, 25 mg.
5-(aminomethyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 190448-73-8) is a chemical compound with the molecular formula C10H15N3O6 and a molecular weight of 273.24 g/mol. IUPAC name: 5-(aminomethyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: ZQVNMALZHZYKQM-JXOAFFINSA-N.
| Molecular formula | C10H15N3O6 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 5-(aminomethyl)-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | ZQVNMALZHZYKQM-JXOAFFINSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)CN |
Computed by PubChem (NCBI)
Synonyms:
5-aminomethyluridine, orb1908504