CAS 2059949-96-9 is the registry number for (5-(Oxan-3-yl)-1,3,4-oxadiazol-2-yl)methanamine, oxalic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Oxalic acid;[5-(oxan-3-yl)-1,3,4-oxadiazol-2-yl]methanamine (CAS 2059949-96-9) is a chemical compound with the molecular formula C10H15N3O6 and a molecular weight of 273.24 g/mol. IUPAC name: oxalic acid;[5-(oxan-3-yl)-1,3,4-oxadiazol-2-yl]methanamine. InChIKey: KYMZDRDDVXIEIG-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O6 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | oxalic acid;[5-(oxan-3-yl)-1,3,4-oxadiazol-2-yl]methanamine |
| InChIKey | KYMZDRDDVXIEIG-UHFFFAOYSA-N |
| SMILES | C1CC(COC1)C2=NN=C(O2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)