Products 1904610-48-5
CAS 1904610-48-5 is the registry number for MAO-B-IN-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(1,3-benzodioxol-4-yl)-1-(4-methylsulfanylphenyl)prop-2-en-1-one (CAS 1904610-48-5) is a chemical compound with the molecular formula C17H14O3S and a molecular weight of 298.4 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-4-yl)-1-(4-methylsulfanylphenyl)prop-2-en-1-one. InChIKey: GKDHWOUMCGRQHR-JXMROGBWSA-N.
| Molecular formula | C17H14O3S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-4-yl)-1-(4-methylsulfanylphenyl)prop-2-en-1-one |
| InChIKey | GKDHWOUMCGRQHR-JXMROGBWSA-N |
| SMILES | CSC1=CC=C(C=C1)C(=O)/C=C/C2=C3C(=CC=C2)OCO3 |
Computed by PubChem (NCBI)