Products 68211-49-4

CAS 68211-49-4 is the registry number for 1-Naphthyl tosylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

Naphthalen-1-yl 4-methylbenzenesulfonate (CAS 68211-49-4) is a chemical compound with the molecular formula C17H14O3S and a molecular weight of 298.4 g/mol. IUPAC name: naphthalen-1-yl 4-methylbenzenesulfonate. InChIKey: IAMYQZXSUPCVDX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14O3S
Molecular weight298.4 g/mol
IUPAC namenaphthalen-1-yl 4-methylbenzenesulfonate
InChIKeyIAMYQZXSUPCVDX-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC3=CC=CC=C32

Computed by PubChem (NCBI)