CAS 68211-49-4 is the registry number for 1-Naphthyl tosylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Naphthalen-1-yl 4-methylbenzenesulfonate (CAS 68211-49-4) is a chemical compound with the molecular formula C17H14O3S and a molecular weight of 298.4 g/mol. IUPAC name: naphthalen-1-yl 4-methylbenzenesulfonate. InChIKey: IAMYQZXSUPCVDX-UHFFFAOYSA-N.
| Molecular formula | C17H14O3S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | naphthalen-1-yl 4-methylbenzenesulfonate |
| InChIKey | IAMYQZXSUPCVDX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)