CAS 1904649-00-8 is the registry number for CPI703. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4R)-6-(1-tert-butylpyrazol-4-yl)-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (CAS 1904649-00-8) is a chemical compound with the molecular formula C17H22N4O and a molecular weight of 298.4 g/mol. IUPAC name: (4R)-6-(1-tert-butylpyrazol-4-yl)-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one. InChIKey: HPSNXSAYALRMQW-LLVKDONJSA-N.
| Molecular formula | C17H22N4O |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (4R)-6-(1-tert-butylpyrazol-4-yl)-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| InChIKey | HPSNXSAYALRMQW-LLVKDONJSA-N |
| SMILES | C[C@@H]1CC(=O)NC2=CC=CC(=C2N1)C3=CN(N=C3)C(C)(C)C |
Computed by PubChem (NCBI)