CAS 190595-66-5 appears in our catalog under these names: Ezetimibe Impurity 1 ((3'S,3R,4S)-Desfluoro Ezetimibe), Ezetimibe Impurity O, Ezetimibe Impurity 9, (3’S,3R,4S)-Desfluoro Ezetimibe, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R,4S)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]azetidin-2-one (CAS 190595-66-5) is a chemical compound with the molecular formula C24H22FNO3 and a molecular weight of 391.4 g/mol. IUPAC name: (3R,4S)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]azetidin-2-one. InChIKey: AZKGJGUGALISLD-XPWALMASSA-N.
| Molecular formula | C24H22FNO3 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (3R,4S)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]azetidin-2-one |
| InChIKey | AZKGJGUGALISLD-XPWALMASSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC[C@@H]2[C@H](N(C2=O)C3=CC=C(C=C3)F)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)