Products 302781-98-2
CAS 302781-98-2 appears in our catalog under these names: Desfluoro-ezetimibe, 98%, Ezetimibe Impurity I；Ezetimibe Desfluoroaniline Analog (USP), Desfluoro Ezetimibe, Desfluoro Ezetimibe, >95% (HPLC), Desfluoro–ezetimibe. Offered by: Fluorochem, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 25mg, on request, 2,5mg, 2500μg, 10mg, 50mg, 100mg, 250mg.
(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-1-phenylazetidin-2-one (CAS 302781-98-2) is a chemical compound with the molecular formula C24H22FNO3 and a molecular weight of 391.4 g/mol. IUPAC name: (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-1-phenylazetidin-2-one. InChIKey: YWZUFJFIXFJKBD-XPWALMASSA-N.
| Molecular formula | C24H22FNO3 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-1-phenylazetidin-2-one |
| InChIKey | YWZUFJFIXFJKBD-XPWALMASSA-N |
| SMILES | C1=CC=C(C=C1)N2[C@@H]([C@H](C2=O)CC[C@@H](C3=CC=C(C=C3)F)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)