CAS 19063-57-1 appears in our catalog under these names: 7-Aminocoumarin, >95% (HPLC), 7-Aminocoumarin, 97%, 7-Aminocoumarin 97%, 7-Amino-2H-chromen-2-one, 97%, 97%, 7-Aminocoumarin, 98.13%. Offered by: TRC, AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 25mg, 50mg, 100mg, 1g, 25 mg, 10 mg, 5 mg.
7-aminochromen-2-one (CAS 19063-57-1) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 7-aminochromen-2-one. InChIKey: RRHXPUCIXLAHIY-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 7-aminochromen-2-one |
| InChIKey | RRHXPUCIXLAHIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)N |
Computed by PubChem (NCBI)