CAS 190774-48-2 is the registry number for 2-Bromo-4,6-difluorophenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-3,5-difluoro-2-isocyanatobenzene (CAS 190774-48-2) is a chemical compound with the molecular formula C7H2BrF2NO and a molecular weight of 234.00 g/mol. IUPAC name: 1-bromo-3,5-difluoro-2-isocyanatobenzene. InChIKey: NPRYGRLJCFTSBA-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF2NO |
|---|---|
| Molecular weight | 234.00 g/mol |
| IUPAC name | 1-bromo-3,5-difluoro-2-isocyanatobenzene |
| InChIKey | NPRYGRLJCFTSBA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N=C=O)Br)F |
Computed by PubChem (NCBI)