CAS 2065250-65-7 is the registry number for 3-Bromo-4,5-difluoro-2-hydroxy-benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3-bromo-4,5-difluoro-2-hydroxybenzonitrile (CAS 2065250-65-7) is a chemical compound with the molecular formula C7H2BrF2NO and a molecular weight of 234.00 g/mol. IUPAC name: 3-bromo-4,5-difluoro-2-hydroxybenzonitrile. InChIKey: WCWZSTYALPUHGA-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF2NO |
|---|---|
| Molecular weight | 234.00 g/mol |
| IUPAC name | 3-bromo-4,5-difluoro-2-hydroxybenzonitrile |
| InChIKey | WCWZSTYALPUHGA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)O)C#N |
Computed by PubChem (NCBI)