CAS 19090-60-9 appears in our catalog under these names: Ammonium adipate, 97%, 97%, Ammonium adipate, 97%, Ammonium adipate 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 500g, 1kg, 1000g.
Diazanium;hexanedioate (CAS 19090-60-9) is a chemical compound with the molecular formula C6H16N2O4 and a molecular weight of 180.20 g/mol. IUPAC name: diazanium;hexanedioate. InChIKey: ZRSKSQHEOZFGLJ-UHFFFAOYSA-N.
| Molecular formula | C6H16N2O4 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | diazanium;hexanedioate |
| InChIKey | ZRSKSQHEOZFGLJ-UHFFFAOYSA-N |
| SMILES | C(CCC(=O)[O-])CC(=O)[O-].[NH4+].[NH4+] |
Computed by PubChem (NCBI)