Products 3385-41-9

CAS 3385-41-9 is the registry number for Hexanedioic acid, diammonium salt, 99%, 99%. Offered by: Chemat. Available pack sizes: 25g, 100g, 500g.

Structural formula: {0} (CAS {1})

Diazanium;hexanedioate (CAS 3385-41-9) is a chemical compound with the molecular formula C6H16N2O4 and a molecular weight of 180.20 g/mol. IUPAC name: diazanium;hexanedioate. InChIKey: ZRSKSQHEOZFGLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H16N2O4
Molecular weight180.20 g/mol
IUPAC namediazanium;hexanedioate
InChIKeyZRSKSQHEOZFGLJ-UHFFFAOYSA-N
SMILESC(CCC(=O)[O-])CC(=O)[O-].[NH4+].[NH4+]

Computed by PubChem (NCBI)