CAS 3385-41-9 is the registry number for Hexanedioic acid, diammonium salt, 99%, 99%. Offered by: Chemat. Available pack sizes: 25g, 100g, 500g.
Diazanium;hexanedioate (CAS 3385-41-9) is a chemical compound with the molecular formula C6H16N2O4 and a molecular weight of 180.20 g/mol. IUPAC name: diazanium;hexanedioate. InChIKey: ZRSKSQHEOZFGLJ-UHFFFAOYSA-N.
| Molecular formula | C6H16N2O4 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | diazanium;hexanedioate |
| InChIKey | ZRSKSQHEOZFGLJ-UHFFFAOYSA-N |
| SMILES | C(CCC(=O)[O-])CC(=O)[O-].[NH4+].[NH4+] |
Computed by PubChem (NCBI)