CAS 190908-40-8 is the registry number for 5,7-Dichlorokynurenic acid . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 10mg, 100mg , 50mg.
5,7-dichloro-4-oxo-1H-quinoline-2-carboxylic acid;hydrate (CAS 190908-40-8) is a chemical compound with the molecular formula C10H7Cl2NO4 and a molecular weight of 276.07 g/mol. IUPAC name: 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylic acid;hydrate. InChIKey: READYYZXDSXRQJ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO4 |
|---|---|
| Molecular weight | 276.07 g/mol |
| IUPAC name | 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylic acid;hydrate |
| InChIKey | READYYZXDSXRQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=CC2=O)C(=O)O)Cl)Cl.O |
Computed by PubChem (NCBI)