CAS 19091-99-7 is the registry number for N-Nitrobenzenemethanamine. Offered by: TRC. Available pack sizes: 500mg.
N-benzylnitramide (CAS 19091-99-7) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: N-benzylnitramide. InChIKey: FJCCWUVWFDOSAU-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | N-benzylnitramide |
| InChIKey | FJCCWUVWFDOSAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN[N+](=O)[O-] |
Computed by PubChem (NCBI)