Products 1909287-35-9
CAS 1909287-35-9 appears in our catalog under these names: (2S)-1-amino-3-(piperidin-1-yl)propan-2-ol dihydrochloride, 95%, (2S)-1-Amino-3-(piperidin-1-yl)propan-2-ol dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(2S)-1-amino-3-piperidin-1-ylpropan-2-ol;dihydrochloride (CAS 1909287-35-9) is a chemical compound with the molecular formula C8H20Cl2N2O and a molecular weight of 231.16 g/mol. IUPAC name: (2S)-1-amino-3-piperidin-1-ylpropan-2-ol;dihydrochloride. InChIKey: FHGTWSNIJDZPPB-JZGIKJSDSA-N.
| Molecular formula | C8H20Cl2N2O |
|---|---|
| Molecular weight | 231.16 g/mol |
| IUPAC name | (2S)-1-amino-3-piperidin-1-ylpropan-2-ol;dihydrochloride |
| InChIKey | FHGTWSNIJDZPPB-JZGIKJSDSA-N |
| SMILES | C1CCN(CC1)C[C@H](CN)O.Cl.Cl |
Computed by PubChem (NCBI)