Products 864655-27-6

CAS 864655-27-6 is the registry number for 2-[Methyl(4-piperidinyl)amino]ethanol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[methyl(piperidin-4-yl)amino]ethanol;dihydrochloride (CAS 864655-27-6) is a chemical compound with the molecular formula C8H20Cl2N2O and a molecular weight of 231.16 g/mol. IUPAC name: 2-[methyl(piperidin-4-yl)amino]ethanol;dihydrochloride. InChIKey: DGPUINMSKCVTOA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H20Cl2N2O
Molecular weight231.16 g/mol
IUPAC name2-[methyl(piperidin-4-yl)amino]ethanol;dihydrochloride
InChIKeyDGPUINMSKCVTOA-UHFFFAOYSA-N
SMILESCN(CCO)C1CCNCC1.Cl.Cl

Computed by PubChem (NCBI)