CAS 1909294-02-5 is the registry number for (1R,2R)-2-(Pyridin-4-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carboxylic acid (CAS 1909294-02-5) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: trans-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carboxylic acid. InChIKey: YFOFMIZNXREQAS-JGVFFNPUSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carboxylic acid |
| InChIKey | YFOFMIZNXREQAS-JGVFFNPUSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)