Products 1909294-02-5

CAS 1909294-02-5 is the registry number for (1R,2R)-2-(Pyridin-4-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carboxylic acid (CAS 1909294-02-5) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: trans-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carboxylic acid. InChIKey: YFOFMIZNXREQAS-JGVFFNPUSA-N.

Identity
Molecular formulaC9H9NO2
Molecular weight163.17 g/mol
IUPAC nametrans-(1R,2R)-2-pyridin-4-ylcyclopropane-1-carboxylic acid
InChIKeyYFOFMIZNXREQAS-JGVFFNPUSA-N
SMILESC1[C@H]([C@@H]1C(=O)O)C2=CC=NC=C2

Computed by PubChem (NCBI)