CAS 1909294-60-5 is the registry number for rac-{1-Methyl-3-((2R,5R)-5-methyloxolan-2-yl)-1H-pyrazol-4-yl}methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1-methyl-3-[(2R,5R)-5-methyloxolan-2-yl]pyrazol-4-yl]methanol (CAS 1909294-60-5) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: [1-methyl-3-[(2R,5R)-5-methyloxolan-2-yl]pyrazol-4-yl]methanol. InChIKey: IKPYXAOZQZSOAU-VXNVDRBHSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | [1-methyl-3-[(2R,5R)-5-methyloxolan-2-yl]pyrazol-4-yl]methanol |
| InChIKey | IKPYXAOZQZSOAU-VXNVDRBHSA-N |
| SMILES | C[C@@H]1CC[C@@H](O1)C2=NN(C=C2CO)C |
Computed by PubChem (NCBI)