CAS 1909294-80-9 is the registry number for rac-(1R,2S,3R)-3-Ethoxy-2-(methylsulfanyl)cyclobutan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,2S,3R)-3-ethoxy-2-methylsulfanylcyclobutan-1-amine;hydrochloride (CAS 1909294-80-9) is a chemical compound with the molecular formula C7H16ClNOS and a molecular weight of 197.73 g/mol. IUPAC name: (1R,2S,3R)-3-ethoxy-2-methylsulfanylcyclobutan-1-amine;hydrochloride. InChIKey: XQJGYLGITNCFBO-IXUZKAFRSA-N.
| Molecular formula | C7H16ClNOS |
|---|---|
| Molecular weight | 197.73 g/mol |
| IUPAC name | (1R,2S,3R)-3-ethoxy-2-methylsulfanylcyclobutan-1-amine;hydrochloride |
| InChIKey | XQJGYLGITNCFBO-IXUZKAFRSA-N |
| SMILES | CCO[C@@H]1C[C@H]([C@@H]1SC)N.Cl |
Computed by PubChem (NCBI)