Products 6050-81-3
CAS 6050-81-3 appears in our catalog under these names: Acetylthiocholine Chloride, Acetylthiocholine chloride, Acetylthiocholine chloride 98%, 2-(Acetylthio)-N,N,N-trimethylethanaminium chloride, 98%, 98%, Acetylthiocholine (chloride), 98.0%. Offered by: TRC, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 25g, 5g, 100mg, 25 g, 5 g, 1 g.
2-acetylsulfanylethyl(trimethyl)azanium chloride (CAS 6050-81-3) is a chemical compound with the molecular formula C7H16ClNOS and a molecular weight of 197.73 g/mol. IUPAC name: 2-acetylsulfanylethyl(trimethyl)azanium chloride. InChIKey: GZYVLKKMMDFCKR-UHFFFAOYSA-M.
| Molecular formula | C7H16ClNOS |
|---|---|
| Molecular weight | 197.73 g/mol |
| IUPAC name | 2-acetylsulfanylethyl(trimethyl)azanium chloride |
| InChIKey | GZYVLKKMMDFCKR-UHFFFAOYSA-M |
| SMILES | CC(=O)SCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Acetylthiocholine chloride, s-Acetylthiocholine chloride, GZYVLKKMMDFCKR-UHFFFAOYSA-M, 2-(Acetylthio)-N,N,N-trimethylethanaminium chloride, 2-Acetylthioethyltrimethylammonium chloride, [2-(acetylsulfanyl)ethyl]trimethylazanium chloride, Ethanaminium, 2-(acetylthio)-N,N,N-trimethyl-, chloride, 2-acetylsulfanylethyl(trimethyl)azanium;chloride, (2-Mercaptoethyl)trimethylammonium chloride acetate, C7H16ClNOS