Products 1909294-96-7
CAS 1909294-96-7 is the registry number for {((2S,4S)-4-Methoxy-1-methylpyrrolidin-2-yl)methyl}(methyl)amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]-N-methylmethanamine (CAS 1909294-96-7) is a chemical compound with the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. IUPAC name: 1-[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]-N-methylmethanamine. InChIKey: CKGRNRCRPCDFOF-YUMQZZPRSA-N.
| Molecular formula | C8H18N2O |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 1-[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]-N-methylmethanamine |
| InChIKey | CKGRNRCRPCDFOF-YUMQZZPRSA-N |
| SMILES | CNC[C@@H]1C[C@@H](CN1C)OC |
Computed by PubChem (NCBI)