Products 1909296-11-2
CAS 1909296-11-2 is the registry number for 1-(1-Ethyl-2-methyl-1H-indol-3-yl)-2,2,2-trifluoroethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-(1-ethyl-2-methylindol-3-yl)-2,2,2-trifluoroethanone (CAS 1909296-11-2) is a chemical compound with the molecular formula C13H12F3NO and a molecular weight of 255.23 g/mol. IUPAC name: 1-(1-ethyl-2-methylindol-3-yl)-2,2,2-trifluoroethanone. InChIKey: HBXKCSAMBZSZOS-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 1-(1-ethyl-2-methylindol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | HBXKCSAMBZSZOS-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C2=CC=CC=C21)C(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)