CAS 51924-57-3 is the registry number for 3-((3-(Trifluoromethyl)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one (CAS 51924-57-3) is a chemical compound with the molecular formula C13H12F3NO and a molecular weight of 255.23 g/mol. IUPAC name: 3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one. InChIKey: BUOMXIHBKTWMPR-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO |
|---|---|
| Molecular weight | 255.23 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one |
| InChIKey | BUOMXIHBKTWMPR-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)