Products 1909301-17-2
CAS 1909301-17-2 is the registry number for rac-(1R,4S)-6-Oxobicyclo(2.2.1)heptane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,4S)-6-oxobicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1909301-17-2) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (1R,4S)-6-oxobicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: RUOYCLYBCGDWPG-YRZWDFBDSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (1R,4S)-6-oxobicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | RUOYCLYBCGDWPG-YRZWDFBDSA-N |
| SMILES | C1[C@H]2CC([C@@H]1C(=O)C2)C(=O)O |
Computed by PubChem (NCBI)