Products 1909305-09-4
CAS 1909305-09-4 is the registry number for 7-Fluoro-2-(2-methylphenyl)quinazoline-4-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-fluoro-2-(2-methylphenyl)-1H-quinazoline-4-thione (CAS 1909305-09-4) is a chemical compound with the molecular formula C15H11FN2S and a molecular weight of 270.3 g/mol. IUPAC name: 7-fluoro-2-(2-methylphenyl)-1H-quinazoline-4-thione. InChIKey: TXUUKIORTLZANB-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2S |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | 7-fluoro-2-(2-methylphenyl)-1H-quinazoline-4-thione |
| InChIKey | TXUUKIORTLZANB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC(=S)C3=C(N2)C=C(C=C3)F |
Computed by PubChem (NCBI)