Products 1909305-55-0

CAS 1909305-55-0 appears in our catalog under these names: 2,6-Dimethylmorpholine-3-carboxylic acid hydrochloride, 95%, 2,6-Dimethylmorpholine-3-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 1000mg, 500mg.

2,6-dimethylmorpholine-3-carboxylic acid;hydrochloride (CAS 1909305-55-0) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: 2,6-dimethylmorpholine-3-carboxylic acid;hydrochloride. InChIKey: DRTGJKKHCJXVBK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO3
Molecular weight195.64 g/mol
IUPAC name2,6-dimethylmorpholine-3-carboxylic acid;hydrochloride
InChIKeyDRTGJKKHCJXVBK-UHFFFAOYSA-N
SMILESCC1CNC(C(O1)C)C(=O)O.Cl

Computed by PubChem (NCBI)