Products 1909309-45-0

CAS 1909309-45-0 appears in our catalog under these names: 4-Ethyl-2-oxo-2,3-dihydro-1,3-thiazole-5-sulfonyl chloride, 95%, 4-Ethyl-2-oxo-2,3-dihydro-1,3-thiazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

4-ethyl-2-oxo-3H-1,3-thiazole-5-sulfonyl chloride (CAS 1909309-45-0) is a chemical compound with the molecular formula C5H6ClNO3S2 and a molecular weight of 227.7 g/mol. IUPAC name: 4-ethyl-2-oxo-3H-1,3-thiazole-5-sulfonyl chloride. InChIKey: YIFANPJICKTIQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6ClNO3S2
Molecular weight227.7 g/mol
IUPAC name4-ethyl-2-oxo-3H-1,3-thiazole-5-sulfonyl chloride
InChIKeyYIFANPJICKTIQJ-UHFFFAOYSA-N
SMILESCCC1=C(SC(=O)N1)S(=O)(=O)Cl

Computed by PubChem (NCBI)