CAS 1909309-45-0 appears in our catalog under these names: 4-Ethyl-2-oxo-2,3-dihydro-1,3-thiazole-5-sulfonyl chloride, 95%, 4-Ethyl-2-oxo-2,3-dihydro-1,3-thiazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-ethyl-2-oxo-3H-1,3-thiazole-5-sulfonyl chloride (CAS 1909309-45-0) is a chemical compound with the molecular formula C5H6ClNO3S2 and a molecular weight of 227.7 g/mol. IUPAC name: 4-ethyl-2-oxo-3H-1,3-thiazole-5-sulfonyl chloride. InChIKey: YIFANPJICKTIQJ-UHFFFAOYSA-N.
| Molecular formula | C5H6ClNO3S2 |
|---|---|
| Molecular weight | 227.7 g/mol |
| IUPAC name | 4-ethyl-2-oxo-3H-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | YIFANPJICKTIQJ-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=O)N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)