CAS 1936670-65-3 appears in our catalog under these names: (3-Methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride, (3-Methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
(3-methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride (CAS 1936670-65-3) is a chemical compound with the molecular formula C5H6ClNO3S2 and a molecular weight of 227.7 g/mol. IUPAC name: (3-methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride. InChIKey: GFYPKHGYRZBUQP-UHFFFAOYSA-N.
| Molecular formula | C5H6ClNO3S2 |
|---|---|
| Molecular weight | 227.7 g/mol |
| IUPAC name | (3-methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride |
| InChIKey | GFYPKHGYRZBUQP-UHFFFAOYSA-N |
| SMILES | COC1=NSC(=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)