Products 1936670-65-3

CAS 1936670-65-3 appears in our catalog under these names: (3-Methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride, (3-Methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

(3-methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride (CAS 1936670-65-3) is a chemical compound with the molecular formula C5H6ClNO3S2 and a molecular weight of 227.7 g/mol. IUPAC name: (3-methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride. InChIKey: GFYPKHGYRZBUQP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6ClNO3S2
Molecular weight227.7 g/mol
IUPAC name(3-methoxy-1,2-thiazol-5-yl)methanesulfonyl chloride
InChIKeyGFYPKHGYRZBUQP-UHFFFAOYSA-N
SMILESCOC1=NSC(=C1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)