CAS 1909309-60-9 appears in our catalog under these names: 1-(Pyridin-4-yl)-1H-1,2,4-triazol-5-amine dihydrochloride, 95%, 1-(Pyridin-4-yl)-1H-1,2,4-triazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-pyridin-4-yl-1,2,4-triazol-3-amine;dihydrochloride (CAS 1909309-60-9) is a chemical compound with the molecular formula C7H9Cl2N5 and a molecular weight of 234.08 g/mol. IUPAC name: 2-pyridin-4-yl-1,2,4-triazol-3-amine;dihydrochloride. InChIKey: GJKSFPXEAGUDFE-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N5 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-pyridin-4-yl-1,2,4-triazol-3-amine;dihydrochloride |
| InChIKey | GJKSFPXEAGUDFE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1N2C(=NC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)