CAS 2504203-42-1 is the registry number for [2-(6-Chloro[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethanamine;hydrochloride (CAS 2504203-42-1) is a chemical compound with the molecular formula C7H9Cl2N5 and a molecular weight of 234.08 g/mol. IUPAC name: 2-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethanamine;hydrochloride. InChIKey: NJCBIDKNSRIARQ-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N5 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethanamine;hydrochloride |
| InChIKey | NJCBIDKNSRIARQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NN=C2CCN)Cl.Cl |
Computed by PubChem (NCBI)