CAS 1909314-10-8 is the registry number for tert-Butyl N-{(1-(methanesulfonyloxy)-2-methylpropan-2-yl)oxy}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropyl] methanesulfonate (CAS 1909314-10-8) is a chemical compound with the molecular formula C10H21NO6S and a molecular weight of 283.34 g/mol. IUPAC name: [2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropyl] methanesulfonate. InChIKey: WHOURPJQOYEMCL-UHFFFAOYSA-N.
| Molecular formula | C10H21NO6S |
|---|---|
| Molecular weight | 283.34 g/mol |
| IUPAC name | [2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropyl] methanesulfonate |
| InChIKey | WHOURPJQOYEMCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOC(C)(C)COS(=O)(=O)C |
Computed by PubChem (NCBI)