Products 1909316-36-4

CAS 1909316-36-4 is the registry number for 5-Chloro-1-methyl-4-nitro-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-chloro-1-methyl-4-nitropyrazole-3-carboxylic acid (CAS 1909316-36-4) is a chemical compound with the molecular formula C5H4ClN3O4 and a molecular weight of 205.55 g/mol. IUPAC name: 5-chloro-1-methyl-4-nitropyrazole-3-carboxylic acid. InChIKey: PTGAUEBFFKSGSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClN3O4
Molecular weight205.55 g/mol
IUPAC name5-chloro-1-methyl-4-nitropyrazole-3-carboxylic acid
InChIKeyPTGAUEBFFKSGSZ-UHFFFAOYSA-N
SMILESCN1C(=C(C(=N1)C(=O)O)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)