CAS 84547-88-6 is the registry number for 4-Chloro-1-methyl-3-nitro-1H-pyrazole-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-1-methyl-3-nitropyrazole-5-carboxylic acid (CAS 84547-88-6) is a chemical compound with the molecular formula C5H4ClN3O4 and a molecular weight of 205.55 g/mol. IUPAC name: 4-chloro-1-methyl-3-nitropyrazole-5-carboxylic acid. InChIKey: ZIBFUEQMNQITNU-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O4 |
|---|---|
| Molecular weight | 205.55 g/mol |
| IUPAC name | 4-chloro-1-methyl-3-nitropyrazole-5-carboxylic acid |
| InChIKey | ZIBFUEQMNQITNU-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)