Products 1909318-88-2
CAS 1909318-88-2 is the registry number for tert-Butyl 9,11-dioxa-4-azatetracyclo(5.3.1.0²,â¶.0â¸,¹â°)undecane-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-4-carboxylate (CAS 1909318-88-2) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: tert-butyl 9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-4-carboxylate. InChIKey: NQMDWNZSIUDGNW-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | tert-butyl 9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-4-carboxylate |
| InChIKey | NQMDWNZSIUDGNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2C(C1)C3C4C(C2O3)O4 |
Computed by PubChem (NCBI)