Products 1909319-82-9
CAS 1909319-82-9 is the registry number for 4-Chloro-7-cyclopentyl-5,6-dimethyl-7H-pyrrolo(2,3-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-7-cyclopentyl-5,6-dimethylpyrrolo[2,3-d]pyrimidine (CAS 1909319-82-9) is a chemical compound with the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. IUPAC name: 4-chloro-7-cyclopentyl-5,6-dimethylpyrrolo[2,3-d]pyrimidine. InChIKey: PTGIYAMDTZJWGW-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3 |
|---|---|
| Molecular weight | 249.74 g/mol |
| IUPAC name | 4-chloro-7-cyclopentyl-5,6-dimethylpyrrolo[2,3-d]pyrimidine |
| InChIKey | PTGIYAMDTZJWGW-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C(=NC=N2)Cl)C3CCCC3)C |
Computed by PubChem (NCBI)