CAS 1909325-59-2 appears in our catalog under these names: 6-(Pyrrolidin-3-yl)-1,2,3,4-tetrahydropyrimidine-2,4-dione hydrochloride, 95%, 6-(Pyrrolidin-3-yl)-1,2,3,4-tetrahydropyrimidine-2,4-dione hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-pyrrolidin-3-yl-1H-pyrimidine-2,4-dione;hydrochloride (CAS 1909325-59-2) is a chemical compound with the molecular formula C8H12ClN3O2 and a molecular weight of 217.65 g/mol. IUPAC name: 6-pyrrolidin-3-yl-1H-pyrimidine-2,4-dione;hydrochloride. InChIKey: QPVKPOMJUJHQJW-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O2 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 6-pyrrolidin-3-yl-1H-pyrimidine-2,4-dione;hydrochloride |
| InChIKey | QPVKPOMJUJHQJW-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=CC(=O)NC(=O)N2.Cl |
Computed by PubChem (NCBI)