CAS 1909336-64-6 appears in our catalog under these names: 2-(4H-1,2,4-Triazole-3-carbonyl)pyridine, 95%, 2-(4H-1,2,4-Triazole-3-carbonyl)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Pyridin-2-yl(1H-1,2,4-triazol-5-yl)methanone (CAS 1909336-64-6) is a chemical compound with the molecular formula C8H6N4O and a molecular weight of 174.16 g/mol. IUPAC name: pyridin-2-yl(1H-1,2,4-triazol-5-yl)methanone. InChIKey: NHFSQGYPPBHEQN-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | pyridin-2-yl(1H-1,2,4-triazol-5-yl)methanone |
| InChIKey | NHFSQGYPPBHEQN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)C2=NC=NN2 |
Computed by PubChem (NCBI)