CAS 1909336-76-0 appears in our catalog under these names: 4-Amino-1,5-naphthyridin-2-ol, 95%, 4-Amino-1,5-naphthyridin-2-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-amino-1H-1,5-naphthyridin-2-one (CAS 1909336-76-0) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 4-amino-1H-1,5-naphthyridin-2-one. InChIKey: BSYZQILBHVKKHQ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 4-amino-1H-1,5-naphthyridin-2-one |
| InChIKey | BSYZQILBHVKKHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CC(=O)N2)N)N=C1 |
Computed by PubChem (NCBI)